C15H16N5NaO5S — CID 23689962
sodium N-[4-(7-imidazol-1-yl-2,3-dioxo-4H-quinoxalin-1-yl)butyl]sulfamate (PubChem CID 23689962) has the molecular formula C15H16N5NaO5S and a molecular weight of 401.38 g/mol. Its IUPAC name is sodium N-[4-(7-imidazol-1-yl-2,3-dioxo-4H-quinoxalin-1-yl)butyl]sulfamate.
| Compound Name | sodium N-[4-(7-imidazol-1-yl-2,3-dioxo-4H-quinoxalin-1-yl)butyl]sulfamate |
|---|---|
| PubChem CID | 23689962 |
| Molecular Formula | C15H16N5NaO5S |
| Molecular Weight | 401.38 g/mol |
| Exact Mass | 401.08 |
| IUPAC Name | sodium N-[4-(7-imidazol-1-yl-2,3-dioxo-4H-quinoxalin-1-yl)butyl]sulfamate |
| SMILES | O=c1[nH]c2ccc(-n3ccnc3)cc2n(CCCCNS(=O)(=O)[O-])c1=O.[Na+] |
| InChI | InChI=1S/C15H17N5O5S.Na/c21-14-15(22)20(7-2-1-5-17-26(23,24)25)13-9-11(3-4-12(13)18-14)19-8-6-16-10-19;/h3-4,6,8-10,17H,1-2,5,7H2,(H,18,21)(H,23,24,25);/q;+1/p-1 |
| InChIKey | UFHJQOAGLWHIHR-UHFFFAOYSA-M |
| XLogP | -3.29 |
| TPSA | 141.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.38 |
| LogP ≤ 5 | -3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|