C18H17N5O9 — CID 21232887
methyl 1-ethyl-2-methylbenzimidazole-5-carboxylate;2,4,6-trinitrophenol (PubChem CID 21232887) has the molecular formula C18H17N5O9 and a molecular weight of 447.36 g/mol. Its IUPAC name is methyl 1-ethyl-2-methylbenzimidazole-5-carboxylate;2,4,6-trinitrophenol.
| Compound Name | methyl 1-ethyl-2-methylbenzimidazole-5-carboxylate;2,4,6-trinitrophenol |
|---|---|
| PubChem CID | 21232887 |
| Molecular Formula | C18H17N5O9 |
| Molecular Weight | 447.36 g/mol |
| Exact Mass | 447.10 |
| IUPAC Name | methyl 1-ethyl-2-methylbenzimidazole-5-carboxylate;2,4,6-trinitrophenol |
| SMILES | CCn1c(C)nc2cc(C(=O)OC)ccc21.O=[N+]([O-])c1cc([N+](=O)[O-])c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H14N2O2.C6H3N3O7/c1-4-14-8(2)13-10-7-9(12(15)16-3)5-6-11(10)14;10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16/h5-7H,4H2,1-3H3;1-2,10H |
| InChIKey | OZIITKRJOUQBBF-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 193.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.36 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|