C16H12N2O7 — CID 3541452
ethyl 5-[(5-nitro-2,3-dioxoindol-1-yl)methyl]furan-2-carboxylate (PubChem CID 3541452) has the molecular formula C16H12N2O7 and a molecular weight of 344.28 g/mol. Its IUPAC name is ethyl 5-[(5-nitro-2,3-dioxoindol-1-yl)methyl]furan-2-carboxylate.
| Compound Name | ethyl 5-[(5-nitro-2,3-dioxoindol-1-yl)methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 3541452 |
| Molecular Formula | C16H12N2O7 |
| Molecular Weight | 344.28 g/mol |
| Exact Mass | 344.06 |
| IUPAC Name | ethyl 5-[(5-nitro-2,3-dioxoindol-1-yl)methyl]furan-2-carboxylate |
| SMILES | CCOC(=O)c1ccc(CN2C(=O)C(=O)c3cc([N+](=O)[O-])ccc32)o1 |
| InChI | InChI=1S/C16H12N2O7/c1-2-24-16(21)13-6-4-10(25-13)8-17-12-5-3-9(18(22)23)7-11(12)14(19)15(17)20/h3-7H,2,8H2,1H3 |
| InChIKey | WLMXJVOOQSHCJK-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 119.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.28 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|