C15H11N3O6S — CID 129218557
1-[(4-nitrophenyl)methyl]-2,3-dioxoindole-5-sulfonamide (PubChem CID 129218557) has the molecular formula C15H11N3O6S and a molecular weight of 361.34 g/mol. Its IUPAC name is 1-[(4-nitrophenyl)methyl]-2,3-dioxoindole-5-sulfonamide.
| Compound Name | 1-[(4-nitrophenyl)methyl]-2,3-dioxoindole-5-sulfonamide |
|---|---|
| PubChem CID | 129218557 |
| Molecular Formula | C15H11N3O6S |
| Molecular Weight | 361.34 g/mol |
| Exact Mass | 361.04 |
| IUPAC Name | 1-[(4-nitrophenyl)methyl]-2,3-dioxoindole-5-sulfonamide |
| SMILES | NS(=O)(=O)c1ccc2c(c1)C(=O)C(=O)N2Cc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C15H11N3O6S/c16-25(23,24)11-5-6-13-12(7-11)14(19)15(20)17(13)8-9-1-3-10(4-2-9)18(21)22/h1-7H,8H2,(H2,16,23,24) |
| InChIKey | SXGPALQOTAXAEA-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 140.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.34 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|