C12H11N3O6 — CID 43509702
N-(2-hydroxyethyl)-2-(5-nitro-2,3-dioxoindol-1-yl)acetamide (PubChem CID 43509702) has the molecular formula C12H11N3O6 and a molecular weight of 293.24 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-2-(5-nitro-2,3-dioxoindol-1-yl)acetamide.
| Compound Name | N-(2-hydroxyethyl)-2-(5-nitro-2,3-dioxoindol-1-yl)acetamide |
|---|---|
| PubChem CID | 43509702 |
| Molecular Formula | C12H11N3O6 |
| Molecular Weight | 293.24 g/mol |
| Exact Mass | 293.06 |
| IUPAC Name | N-(2-hydroxyethyl)-2-(5-nitro-2,3-dioxoindol-1-yl)acetamide |
| SMILES | O=C(CN1C(=O)C(=O)c2cc([N+](=O)[O-])ccc21)NCCO |
| InChI | InChI=1S/C12H11N3O6/c16-4-3-13-10(17)6-14-9-2-1-7(15(20)21)5-8(9)11(18)12(14)19/h1-2,5,16H,3-4,6H2,(H,13,17) |
| InChIKey | WYGYMHCEQWEWOV-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 129.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.24 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|