C22H22N2O8 — CID 93331639
ethyl (4S)-1-[(5-methoxycarbonylfuran-2-yl)methyl]-6-methyl-4-(3-nitrophenyl)-2-oxo-3,4-dihydropyridine-5-carboxylate (PubChem CID 93331639) has the molecular formula C22H22N2O8 and a molecular weight of 442.42 g/mol. Its IUPAC name is ethyl (4S)-1-[(5-methoxycarbonylfuran-2-yl)methyl]-6-methyl-4-(3-nitrophenyl)-2-oxo-3,4-dihydropyridine-5-carboxylate.
| Compound Name | ethyl (4S)-1-[(5-methoxycarbonylfuran-2-yl)methyl]-6-methyl-4-(3-nitrophenyl)-2-oxo-3,4-dihydropyridine-5-carboxylate |
|---|---|
| PubChem CID | 93331639 |
| Molecular Formula | C22H22N2O8 |
| Molecular Weight | 442.42 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | ethyl (4S)-1-[(5-methoxycarbonylfuran-2-yl)methyl]-6-methyl-4-(3-nitrophenyl)-2-oxo-3,4-dihydropyridine-5-carboxylate |
| SMILES | CCOC(=O)C1=C(C)N(Cc2ccc(C(=O)OC)o2)C(=O)C[C@H]1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H22N2O8/c1-4-31-22(27)20-13(2)23(12-16-8-9-18(32-16)21(26)30-3)19(25)11-17(20)14-6-5-7-15(10-14)24(28)29/h5-10,17H,4,11-12H2,1-3H3/t17-/m0/s1 |
| InChIKey | DPGTWFBGXBSMNC-KRWDZBQOSA-N |
| XLogP | 3.33 |
| TPSA | 129.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.42 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|