C33H38N2O6 — CID 4619626
ethyl 1-[[5-(hexylcarbamoyl)furan-2-yl]methyl]-6-methyl-2-oxo-4-(3-phenoxyphenyl)-3,4-dihydropyridine-5-carboxylate (PubChem CID 4619626) has the molecular formula C33H38N2O6 and a molecular weight of 558.68 g/mol. Its IUPAC name is ethyl 1-[[5-(hexylcarbamoyl)furan-2-yl]methyl]-6-methyl-2-oxo-4-(3-phenoxyphenyl)-3,4-dihydropyridine-5-carboxylate.
| Compound Name | ethyl 1-[[5-(hexylcarbamoyl)furan-2-yl]methyl]-6-methyl-2-oxo-4-(3-phenoxyphenyl)-3,4-dihydropyridine-5-carboxylate |
|---|---|
| PubChem CID | 4619626 |
| Molecular Formula | C33H38N2O6 |
| Molecular Weight | 558.68 g/mol |
| Exact Mass | 558.27 |
| IUPAC Name | ethyl 1-[[5-(hexylcarbamoyl)furan-2-yl]methyl]-6-methyl-2-oxo-4-(3-phenoxyphenyl)-3,4-dihydropyridine-5-carboxylate |
| SMILES | CCCCCCNC(=O)c1ccc(CN2C(=O)CC(c3cccc(Oc4ccccc4)c3)C(C(=O)OCC)=C2C)o1 |
| InChI | InChI=1S/C33H38N2O6/c1-4-6-7-11-19-34-32(37)29-18-17-27(41-29)22-35-23(3)31(33(38)39-5-2)28(21-30(35)36)24-13-12-16-26(20-24)40-25-14-9-8-10-15-25/h8-10,12-18,20,28H,4-7,11,19,21-22H2,1-3H3,(H,34,37) |
| InChIKey | WRMBOLXRDLOXLV-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 98.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.68 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|