C24H24F2N2O5 — CID 93332198
2-methylpropyl (4S)-1-[(2,4-difluorophenyl)methyl]-6-methyl-4-(3-nitrophenyl)-2-oxo-3,4-dihydropyridine-5-carboxylate (PubChem CID 93332198) has the molecular formula C24H24F2N2O5 and a molecular weight of 458.46 g/mol. Its IUPAC name is 2-methylpropyl (4S)-1-[(2,4-difluorophenyl)methyl]-6-methyl-4-(3-nitrophenyl)-2-oxo-3,4-dihydropyridine-5-carboxylate.
| Compound Name | 2-methylpropyl (4S)-1-[(2,4-difluorophenyl)methyl]-6-methyl-4-(3-nitrophenyl)-2-oxo-3,4-dihydropyridine-5-carboxylate |
|---|---|
| PubChem CID | 93332198 |
| Molecular Formula | C24H24F2N2O5 |
| Molecular Weight | 458.46 g/mol |
| Exact Mass | 458.17 |
| IUPAC Name | 2-methylpropyl (4S)-1-[(2,4-difluorophenyl)methyl]-6-methyl-4-(3-nitrophenyl)-2-oxo-3,4-dihydropyridine-5-carboxylate |
| SMILES | CC1=C(C(=O)OCC(C)C)[C@H](c2cccc([N+](=O)[O-])c2)CC(=O)N1Cc1ccc(F)cc1F |
| InChI | InChI=1S/C24H24F2N2O5/c1-14(2)13-33-24(30)23-15(3)27(12-17-7-8-18(25)10-21(17)26)22(29)11-20(23)16-5-4-6-19(9-16)28(31)32/h4-10,14,20H,11-13H2,1-3H3/t20-/m0/s1 |
| InChIKey | MPBFEPPQOLSHDO-FQEVSTJZSA-N |
| XLogP | 4.86 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.46 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|