C24H25FN2O5 — CID 42854877
2-methylpropyl 1-[(3-fluorophenyl)methyl]-6-methyl-4-(3-nitrophenyl)-2-oxo-3,4-dihydropyridine-5-carboxylate (PubChem CID 42854877) has the molecular formula C24H25FN2O5 and a molecular weight of 440.47 g/mol. Its IUPAC name is 2-methylpropyl 1-[(3-fluorophenyl)methyl]-6-methyl-4-(3-nitrophenyl)-2-oxo-3,4-dihydropyridine-5-carboxylate.
| Compound Name | 2-methylpropyl 1-[(3-fluorophenyl)methyl]-6-methyl-4-(3-nitrophenyl)-2-oxo-3,4-dihydropyridine-5-carboxylate |
|---|---|
| PubChem CID | 42854877 |
| Molecular Formula | C24H25FN2O5 |
| Molecular Weight | 440.47 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | 2-methylpropyl 1-[(3-fluorophenyl)methyl]-6-methyl-4-(3-nitrophenyl)-2-oxo-3,4-dihydropyridine-5-carboxylate |
| SMILES | CC1=C(C(=O)OCC(C)C)C(c2cccc([N+](=O)[O-])c2)CC(=O)N1Cc1cccc(F)c1 |
| InChI | InChI=1S/C24H25FN2O5/c1-15(2)14-32-24(29)23-16(3)26(13-17-6-4-8-19(25)10-17)22(28)12-21(23)18-7-5-9-20(11-18)27(30)31/h4-11,15,21H,12-14H2,1-3H3 |
| InChIKey | VICYBDCBRBEHDD-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.47 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|