5-methyl-8-nitro-4-oxopyrano[3,2-b]indole-2-carboxylic acid

C13H8N2O6 — CID 12628432

IUPAC5-methyl-8-nitro-4-oxopyrano[3,2-b]indole-2-carboxylic acid
SMILESCn1c2ccc([N+](=O)[O-])cc2c2oc(C(=O)O)cc(=O)c21
InChIInChI=1S/C13H8N2O6/c1-14-8-3-2-6(15(19)20)4-7(8)12-11(14)9(16)5-10(21-12)13(17)18/h2-5H,1H3,(H,17,18)
InChIKeyRHGDQKHLNBOKLA-UHFFFAOYSA-N
MW288.22 g/mol
LogP1.89
Rot. Bonds2

About 5-methyl-8-nitro-4-oxopyrano[3,2-b]indole-2-carboxylic acid

5-methyl-8-nitro-4-oxopyrano[3,2-b]indole-2-carboxylic acid (PubChem CID 12628432) has the molecular formula C13H8N2O6 and a molecular weight of 288.22 g/mol. Its IUPAC name is 5-methyl-8-nitro-4-oxopyrano[3,2-b]indole-2-carboxylic acid.

Molecular Properties

Compound Name5-methyl-8-nitro-4-oxopyrano[3,2-b]indole-2-carboxylic acid
PubChem CID12628432
Molecular FormulaC13H8N2O6
Molecular Weight288.22 g/mol
Exact Mass288.04
IUPAC Name5-methyl-8-nitro-4-oxopyrano[3,2-b]indole-2-carboxylic acid
SMILESCn1c2ccc([N+](=O)[O-])cc2c2oc(C(=O)O)cc(=O)c21
InChIInChI=1S/C13H8N2O6/c1-14-8-3-2-6(15(19)20)4-7(8)12-11(14)9(16)5-10(21-12)13(17)18/h2-5H,1H3,(H,17,18)
InChIKeyRHGDQKHLNBOKLA-UHFFFAOYSA-N
XLogP1.89
TPSA115.58 Ų
H-Bond Donors1
H-Bond Acceptors6
Rotatable Bonds2
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500288.22
LogP ≤ 51.89
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 5-methyl-8-nitro-4-oxopyrano[3,2-b]indole-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-methyl-8-nitro-4-oxopyrano[3,2-b]indole-2-carboxylic acid?
The IUPAC name of 5-methyl-8-nitro-4-oxopyrano[3,2-b]indole-2-carboxylic acid (CID 12628432) is 5-methyl-8-nitro-4-oxopyrano[3,2-b]indole-2-carboxylic acid.
What is the SMILES notation for 5-methyl-8-nitro-4-oxopyrano[3,2-b]indole-2-carboxylic acid?
The canonical SMILES for 5-methyl-8-nitro-4-oxopyrano[3,2-b]indole-2-carboxylic acid is Cn1c2ccc([N+](=O)[O-])cc2c2oc(C(=O)O)cc(=O)c21.
What is the InChIKey of 5-methyl-8-nitro-4-oxopyrano[3,2-b]indole-2-carboxylic acid?
The InChIKey is RHGDQKHLNBOKLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8N2O6/c1-14-8-3-2-6(15(19)20)4-7(8)12-11(14)9(16)5-10(21-12)13(17)18/h2-5H,1H3,(H,17,18).
What are the key properties of 5-methyl-8-nitro-4-oxopyrano[3,2-b]indole-2-carboxylic acid?
5-methyl-8-nitro-4-oxopyrano[3,2-b]indole-2-carboxylic acid has a molecular weight of 288.22 g/mol, XLogP of 1.89, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-8-nitro-4-oxopyrano[3,2-b]indole-2-carboxylic acid is sourced from PubChem (CID 12628432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).