C16H14N2O5 — CID 68882457
1-methoxy-2,9-dimethyl-6-nitrocarbazole-4-carboxylic acid (PubChem CID 68882457) has the molecular formula C16H14N2O5 and a molecular weight of 314.30 g/mol. Its IUPAC name is 1-methoxy-2,9-dimethyl-6-nitrocarbazole-4-carboxylic acid.
| Compound Name | 1-methoxy-2,9-dimethyl-6-nitrocarbazole-4-carboxylic acid |
|---|---|
| PubChem CID | 68882457 |
| Molecular Formula | C16H14N2O5 |
| Molecular Weight | 314.30 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | 1-methoxy-2,9-dimethyl-6-nitrocarbazole-4-carboxylic acid |
| SMILES | COc1c(C)cc(C(=O)O)c2c3cc([N+](=O)[O-])ccc3n(C)c12 |
| InChI | InChI=1S/C16H14N2O5/c1-8-6-11(16(19)20)13-10-7-9(18(21)22)4-5-12(10)17(2)14(13)15(8)23-3/h4-7H,1-3H3,(H,19,20) |
| InChIKey | RRDHJDNYSVYFOP-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 94.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.30 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|