C16H13N3O7 — CID 4980070
dimethyl 5-methyl-8-nitro-4-oxo-2H-pyrrolo[3,4-c]quinoline-1,3-dicarboxylate (PubChem CID 4980070) has the molecular formula C16H13N3O7 and a molecular weight of 359.29 g/mol. Its IUPAC name is dimethyl 5-methyl-8-nitro-4-oxo-2H-pyrrolo[3,4-c]quinoline-1,3-dicarboxylate.
| Compound Name | dimethyl 5-methyl-8-nitro-4-oxo-2H-pyrrolo[3,4-c]quinoline-1,3-dicarboxylate |
|---|---|
| PubChem CID | 4980070 |
| Molecular Formula | C16H13N3O7 |
| Molecular Weight | 359.29 g/mol |
| Exact Mass | 359.08 |
| IUPAC Name | dimethyl 5-methyl-8-nitro-4-oxo-2H-pyrrolo[3,4-c]quinoline-1,3-dicarboxylate |
| SMILES | COC(=O)c1[nH]c(C(=O)OC)c2c1c(=O)n(C)c1ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C16H13N3O7/c1-18-9-5-4-7(19(23)24)6-8(9)10-11(14(18)20)13(16(22)26-3)17-12(10)15(21)25-2/h4-6,17H,1-3H3 |
| InChIKey | PLAJFALHWBNNOE-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 133.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.29 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|