C20H15N3O5 — CID 15941871
methyl 5-methyl-2-(3-nitrophenyl)-1-oxopyrido[4,3-b]indole-4-carboxylate (PubChem CID 15941871) has the molecular formula C20H15N3O5 and a molecular weight of 377.36 g/mol. Its IUPAC name is methyl 5-methyl-2-(3-nitrophenyl)-1-oxopyrido[4,3-b]indole-4-carboxylate.
| Compound Name | methyl 5-methyl-2-(3-nitrophenyl)-1-oxopyrido[4,3-b]indole-4-carboxylate |
|---|---|
| PubChem CID | 15941871 |
| Molecular Formula | C20H15N3O5 |
| Molecular Weight | 377.36 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | methyl 5-methyl-2-(3-nitrophenyl)-1-oxopyrido[4,3-b]indole-4-carboxylate |
| SMILES | COC(=O)c1cn(-c2cccc([N+](=O)[O-])c2)c(=O)c2c3ccccc3n(C)c12 |
| InChI | InChI=1S/C20H15N3O5/c1-21-16-9-4-3-8-14(16)17-18(21)15(20(25)28-2)11-22(19(17)24)12-6-5-7-13(10-12)23(26)27/h3-11H,1-2H3 |
| InChIKey | PTQWBWNUTUDTQB-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 96.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.36 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|