C13H15N3O2 — CID 82232102
2,5-dimethyl-8-nitro-3,4-dihydro-1H-pyrido[4,3-b]indole (PubChem CID 82232102) has the molecular formula C13H15N3O2 and a molecular weight of 245.28 g/mol. Its IUPAC name is 2,5-dimethyl-8-nitro-3,4-dihydro-1H-pyrido[4,3-b]indole.
| Compound Name | 2,5-dimethyl-8-nitro-3,4-dihydro-1H-pyrido[4,3-b]indole |
|---|---|
| PubChem CID | 82232102 |
| Molecular Formula | C13H15N3O2 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | 2,5-dimethyl-8-nitro-3,4-dihydro-1H-pyrido[4,3-b]indole |
| SMILES | CN1CCc2c(c3cc([N+](=O)[O-])ccc3n2C)C1 |
| InChI | InChI=1S/C13H15N3O2/c1-14-6-5-13-11(8-14)10-7-9(16(17)18)3-4-12(10)15(13)2/h3-4,7H,5-6,8H2,1-2H3 |
| InChIKey | QPXBWTCIEDATKQ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 51.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|