C19H21N3O2S — CID 71007712
4-(2,8-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)benzenesulfonamide (PubChem CID 71007712) has the molecular formula C19H21N3O2S and a molecular weight of 355.46 g/mol. Its IUPAC name is 4-(2,8-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)benzenesulfonamide.
| Compound Name | 4-(2,8-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 71007712 |
| Molecular Formula | C19H21N3O2S |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | 4-(2,8-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)benzenesulfonamide |
| SMILES | Cc1ccc2c(c1)c1c(n2-c2ccc(S(N)(=O)=O)cc2)CCN(C)C1 |
| InChI | InChI=1S/C19H21N3O2S/c1-13-3-8-18-16(11-13)17-12-21(2)10-9-19(17)22(18)14-4-6-15(7-5-14)25(20,23)24/h3-8,11H,9-10,12H2,1-2H3,(H2,20,23,24) |
| InChIKey | STYKCBSBQLDALQ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 68.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |