C27H25FN2 — CID 59455193
5-[(E)-2-fluoro-1,2-diphenylethenyl]-2,8-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indole (PubChem CID 59455193) has the molecular formula C27H25FN2 and a molecular weight of 396.51 g/mol. Its IUPAC name is 5-[(E)-2-fluoro-1,2-diphenylethenyl]-2,8-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indole.
| Compound Name | 5-[(E)-2-fluoro-1,2-diphenylethenyl]-2,8-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indole |
|---|---|
| PubChem CID | 59455193 |
| Molecular Formula | C27H25FN2 |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | 5-[(E)-2-fluoro-1,2-diphenylethenyl]-2,8-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indole |
| SMILES | Cc1ccc2c(c1)c1c(n2/C(=C(/F)c2ccccc2)c2ccccc2)CCN(C)C1 |
| InChI | InChI=1S/C27H25FN2/c1-19-13-14-24-22(17-19)23-18-29(2)16-15-25(23)30(24)27(21-11-7-4-8-12-21)26(28)20-9-5-3-6-10-20/h3-14,17H,15-16,18H2,1-2H3/b27-26+ |
| InChIKey | RKGNBVCWMUWAHF-CYYJNZCTSA-N |
| XLogP | 6.28 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|