C23H26N2O — CID 90294083
1-[(2,8-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)methyl]-2,3-dihydroinden-1-ol (PubChem CID 90294083) has the molecular formula C23H26N2O and a molecular weight of 346.47 g/mol. Its IUPAC name is 1-[(2,8-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)methyl]-2,3-dihydroinden-1-ol.
| Compound Name | 1-[(2,8-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)methyl]-2,3-dihydroinden-1-ol |
|---|---|
| PubChem CID | 90294083 |
| Molecular Formula | C23H26N2O |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | 1-[(2,8-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)methyl]-2,3-dihydroinden-1-ol |
| SMILES | Cc1ccc2c(c1)c1c(n2CC2(O)CCc3ccccc32)CCN(C)C1 |
| InChI | InChI=1S/C23H26N2O/c1-16-7-8-21-18(13-16)19-14-24(2)12-10-22(19)25(21)15-23(26)11-9-17-5-3-4-6-20(17)23/h3-8,13,26H,9-12,14-15H2,1-2H3 |
| InChIKey | PVZYNEVILPLJHX-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 28.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|