C22H24N2O2 — CID 157324412
1-[4-[(2,8-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)methyl]phenyl]-2-hydroxyethanone (PubChem CID 157324412) has the molecular formula C22H24N2O2 and a molecular weight of 348.45 g/mol. Its IUPAC name is 1-[4-[(2,8-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)methyl]phenyl]-2-hydroxyethanone.
| Compound Name | 1-[4-[(2,8-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)methyl]phenyl]-2-hydroxyethanone |
|---|---|
| PubChem CID | 157324412 |
| Molecular Formula | C22H24N2O2 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | 1-[4-[(2,8-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)methyl]phenyl]-2-hydroxyethanone |
| SMILES | Cc1ccc2c(c1)c1c(n2Cc2ccc(C(=O)CO)cc2)CCN(C)C1 |
| InChI | InChI=1S/C22H24N2O2/c1-15-3-8-20-18(11-15)19-13-23(2)10-9-21(19)24(20)12-16-4-6-17(7-5-16)22(26)14-25/h3-8,11,25H,9-10,12-14H2,1-2H3 |
| InChIKey | BHAXLUNLUMSCHE-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 45.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|