C24H28N4O4 — CID 55458088
4-hexoxy-N'-[3-(4-oxocinnolin-1-yl)propanoyl]benzohydrazide (PubChem CID 55458088) has the molecular formula C24H28N4O4 and a molecular weight of 436.51 g/mol. Its IUPAC name is 4-hexoxy-N'-[3-(4-oxocinnolin-1-yl)propanoyl]benzohydrazide.
| Compound Name | 4-hexoxy-N'-[3-(4-oxocinnolin-1-yl)propanoyl]benzohydrazide |
|---|---|
| PubChem CID | 55458088 |
| Molecular Formula | C24H28N4O4 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | 4-hexoxy-N'-[3-(4-oxocinnolin-1-yl)propanoyl]benzohydrazide |
| SMILES | CCCCCCOc1ccc(C(=O)NNC(=O)CCn2ncc(=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C24H28N4O4/c1-2-3-4-7-16-32-19-12-10-18(11-13-19)24(31)27-26-23(30)14-15-28-21-9-6-5-8-20(21)22(29)17-25-28/h5-6,8-13,17H,2-4,7,14-16H2,1H3,(H,26,30)(H,27,31) |
| InChIKey | FSNXOVFOQUBLQT-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|