C18H15FN4O3 — CID 51255034
2-fluoro-N'-[3-(4-oxocinnolin-1-yl)propanoyl]benzohydrazide (PubChem CID 51255034) has the molecular formula C18H15FN4O3 and a molecular weight of 354.34 g/mol. Its IUPAC name is 2-fluoro-N'-[3-(4-oxocinnolin-1-yl)propanoyl]benzohydrazide.
| Compound Name | 2-fluoro-N'-[3-(4-oxocinnolin-1-yl)propanoyl]benzohydrazide |
|---|---|
| PubChem CID | 51255034 |
| Molecular Formula | C18H15FN4O3 |
| Molecular Weight | 354.34 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | 2-fluoro-N'-[3-(4-oxocinnolin-1-yl)propanoyl]benzohydrazide |
| SMILES | O=C(CCn1ncc(=O)c2ccccc21)NNC(=O)c1ccccc1F |
| InChI | InChI=1S/C18H15FN4O3/c19-14-7-3-1-5-12(14)18(26)22-21-17(25)9-10-23-15-8-4-2-6-13(15)16(24)11-20-23/h1-8,11H,9-10H2,(H,21,25)(H,22,26) |
| InChIKey | FZSRLPIZARSLMJ-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.34 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|