C18H15ClN4O4 — CID 55444215
[2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] 3-(4-oxocinnolin-1-yl)propanoate (PubChem CID 55444215) has the molecular formula C18H15ClN4O4 and a molecular weight of 386.80 g/mol. Its IUPAC name is [2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] 3-(4-oxocinnolin-1-yl)propanoate.
| Compound Name | [2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] 3-(4-oxocinnolin-1-yl)propanoate |
|---|---|
| PubChem CID | 55444215 |
| Molecular Formula | C18H15ClN4O4 |
| Molecular Weight | 386.80 g/mol |
| Exact Mass | 386.08 |
| IUPAC Name | [2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] 3-(4-oxocinnolin-1-yl)propanoate |
| SMILES | O=C(COC(=O)CCn1ncc(=O)c2ccccc21)Nc1ccc(Cl)cn1 |
| InChI | InChI=1S/C18H15ClN4O4/c19-12-5-6-16(20-9-12)22-17(25)11-27-18(26)7-8-23-14-4-2-1-3-13(14)15(24)10-21-23/h1-6,9-10H,7-8,11H2,(H,20,22,25) |
| InChIKey | CIYTZCNTFOVKQQ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 103.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.80 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |