C20H15ClF3N3O4 — CID 55444173
[2-[2-chloro-6-(trifluoromethyl)anilino]-2-oxoethyl] 3-(4-oxocinnolin-1-yl)propanoate (PubChem CID 55444173) has the molecular formula C20H15ClF3N3O4 and a molecular weight of 453.80 g/mol. Its IUPAC name is [2-[2-chloro-6-(trifluoromethyl)anilino]-2-oxoethyl] 3-(4-oxocinnolin-1-yl)propanoate.
| Compound Name | [2-[2-chloro-6-(trifluoromethyl)anilino]-2-oxoethyl] 3-(4-oxocinnolin-1-yl)propanoate |
|---|---|
| PubChem CID | 55444173 |
| Molecular Formula | C20H15ClF3N3O4 |
| Molecular Weight | 453.80 g/mol |
| Exact Mass | 453.07 |
| IUPAC Name | [2-[2-chloro-6-(trifluoromethyl)anilino]-2-oxoethyl] 3-(4-oxocinnolin-1-yl)propanoate |
| SMILES | O=C(COC(=O)CCn1ncc(=O)c2ccccc21)Nc1c(Cl)cccc1C(F)(F)F |
| InChI | InChI=1S/C20H15ClF3N3O4/c21-14-6-3-5-13(20(22,23)24)19(14)26-17(29)11-31-18(30)8-9-27-15-7-2-1-4-12(15)16(28)10-25-27/h1-7,10H,8-9,11H2,(H,26,29) |
| InChIKey | YVWUFUUBVXSIKR-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.80 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |