C25H20ClN3O4S — CID 55444194
[2-[2-(4-chlorophenyl)sulfanylanilino]-2-oxoethyl] 3-(4-oxocinnolin-1-yl)propanoate (PubChem CID 55444194) has the molecular formula C25H20ClN3O4S and a molecular weight of 493.97 g/mol. Its IUPAC name is [2-[2-(4-chlorophenyl)sulfanylanilino]-2-oxoethyl] 3-(4-oxocinnolin-1-yl)propanoate.
| Compound Name | [2-[2-(4-chlorophenyl)sulfanylanilino]-2-oxoethyl] 3-(4-oxocinnolin-1-yl)propanoate |
|---|---|
| PubChem CID | 55444194 |
| Molecular Formula | C25H20ClN3O4S |
| Molecular Weight | 493.97 g/mol |
| Exact Mass | 493.09 |
| IUPAC Name | [2-[2-(4-chlorophenyl)sulfanylanilino]-2-oxoethyl] 3-(4-oxocinnolin-1-yl)propanoate |
| SMILES | O=C(COC(=O)CCn1ncc(=O)c2ccccc21)Nc1ccccc1Sc1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H20ClN3O4S/c26-17-9-11-18(12-10-17)34-23-8-4-2-6-20(23)28-24(31)16-33-25(32)13-14-29-21-7-3-1-5-19(21)22(30)15-27-29/h1-12,15H,13-14,16H2,(H,28,31) |
| InChIKey | PCYSRVKNEOTFEL-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.97 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |