C18H15Cl2N3OS — CID 19542004
N-[2-(4-chlorophenyl)sulfanylphenyl]-3-(4-chloropyrazol-1-yl)propanamide (PubChem CID 19542004) has the molecular formula C18H15Cl2N3OS and a molecular weight of 392.31 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)sulfanylphenyl]-3-(4-chloropyrazol-1-yl)propanamide.
| Compound Name | N-[2-(4-chlorophenyl)sulfanylphenyl]-3-(4-chloropyrazol-1-yl)propanamide |
|---|---|
| PubChem CID | 19542004 |
| Molecular Formula | C18H15Cl2N3OS |
| Molecular Weight | 392.31 g/mol |
| Exact Mass | 391.03 |
| IUPAC Name | N-[2-(4-chlorophenyl)sulfanylphenyl]-3-(4-chloropyrazol-1-yl)propanamide |
| SMILES | O=C(CCn1cc(Cl)cn1)Nc1ccccc1Sc1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H15Cl2N3OS/c19-13-5-7-15(8-6-13)25-17-4-2-1-3-16(17)22-18(24)9-10-23-12-14(20)11-21-23/h1-8,11-12H,9-10H2,(H,22,24) |
| InChIKey | AEVLKCCUWPOTCU-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.31 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |