C17H13ClIN3OS — CID 19264116
N-[2-(4-chlorophenyl)sulfanylphenyl]-4-iodo-1-methylpyrazole-3-carboxamide (PubChem CID 19264116) has the molecular formula C17H13ClIN3OS and a molecular weight of 469.74 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)sulfanylphenyl]-4-iodo-1-methylpyrazole-3-carboxamide.
| Compound Name | N-[2-(4-chlorophenyl)sulfanylphenyl]-4-iodo-1-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19264116 |
| Molecular Formula | C17H13ClIN3OS |
| Molecular Weight | 469.74 g/mol |
| Exact Mass | 468.95 |
| IUPAC Name | N-[2-(4-chlorophenyl)sulfanylphenyl]-4-iodo-1-methylpyrazole-3-carboxamide |
| SMILES | Cn1cc(I)c(C(=O)Nc2ccccc2Sc2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C17H13ClIN3OS/c1-22-10-13(19)16(21-22)17(23)20-14-4-2-3-5-15(14)24-12-8-6-11(18)7-9-12/h2-10H,1H3,(H,20,23) |
| InChIKey | JFRGAEGRSRUTIW-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.74 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|