C23H17Cl2N3O2S — CID 19507015
2-[(2-chlorophenoxy)methyl]-N-[2-(4-chlorophenyl)sulfanylphenyl]pyrazole-3-carboxamide (PubChem CID 19507015) has the molecular formula C23H17Cl2N3O2S and a molecular weight of 470.38 g/mol. Its IUPAC name is 2-[(2-chlorophenoxy)methyl]-N-[2-(4-chlorophenyl)sulfanylphenyl]pyrazole-3-carboxamide.
| Compound Name | 2-[(2-chlorophenoxy)methyl]-N-[2-(4-chlorophenyl)sulfanylphenyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19507015 |
| Molecular Formula | C23H17Cl2N3O2S |
| Molecular Weight | 470.38 g/mol |
| Exact Mass | 469.04 |
| IUPAC Name | 2-[(2-chlorophenoxy)methyl]-N-[2-(4-chlorophenyl)sulfanylphenyl]pyrazole-3-carboxamide |
| SMILES | O=C(Nc1ccccc1Sc1ccc(Cl)cc1)c1ccnn1COc1ccccc1Cl |
| InChI | InChI=1S/C23H17Cl2N3O2S/c24-16-9-11-17(12-10-16)31-22-8-4-2-6-19(22)27-23(29)20-13-14-26-28(20)15-30-21-7-3-1-5-18(21)25/h1-14H,15H2,(H,27,29) |
| InChIKey | FVUQYCOUMOPMSJ-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.38 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |