C21H23ClN4O2 — CID 19507003
2-[(2-chlorophenoxy)methyl]-N-[4-(diethylamino)phenyl]pyrazole-3-carboxamide (PubChem CID 19507003) has the molecular formula C21H23ClN4O2 and a molecular weight of 398.89 g/mol. Its IUPAC name is 2-[(2-chlorophenoxy)methyl]-N-[4-(diethylamino)phenyl]pyrazole-3-carboxamide.
| Compound Name | 2-[(2-chlorophenoxy)methyl]-N-[4-(diethylamino)phenyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19507003 |
| Molecular Formula | C21H23ClN4O2 |
| Molecular Weight | 398.89 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | 2-[(2-chlorophenoxy)methyl]-N-[4-(diethylamino)phenyl]pyrazole-3-carboxamide |
| SMILES | CCN(CC)c1ccc(NC(=O)c2ccnn2COc2ccccc2Cl)cc1 |
| InChI | InChI=1S/C21H23ClN4O2/c1-3-25(4-2)17-11-9-16(10-12-17)24-21(27)19-13-14-23-26(19)15-28-20-8-6-5-7-18(20)22/h5-14H,3-4,15H2,1-2H3,(H,24,27) |
| InChIKey | VMPMVRHFHKHLQI-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.89 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|