C17H9ClF5N3O2 — CID 19507080
2-[(2-chlorophenoxy)methyl]-N-(2,3,4,5,6-pentafluorophenyl)pyrazole-3-carboxamide (PubChem CID 19507080) has the molecular formula C17H9ClF5N3O2 and a molecular weight of 417.72 g/mol. Its IUPAC name is 2-[(2-chlorophenoxy)methyl]-N-(2,3,4,5,6-pentafluorophenyl)pyrazole-3-carboxamide.
| Compound Name | 2-[(2-chlorophenoxy)methyl]-N-(2,3,4,5,6-pentafluorophenyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19507080 |
| Molecular Formula | C17H9ClF5N3O2 |
| Molecular Weight | 417.72 g/mol |
| Exact Mass | 417.03 |
| IUPAC Name | 2-[(2-chlorophenoxy)methyl]-N-(2,3,4,5,6-pentafluorophenyl)pyrazole-3-carboxamide |
| SMILES | O=C(Nc1c(F)c(F)c(F)c(F)c1F)c1ccnn1COc1ccccc1Cl |
| InChI | InChI=1S/C17H9ClF5N3O2/c18-8-3-1-2-4-10(8)28-7-26-9(5-6-24-26)17(27)25-16-14(22)12(20)11(19)13(21)15(16)23/h1-6H,7H2,(H,25,27) |
| InChIKey | GBUCSXSSHYTDLC-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.72 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|