C23H18ClN3O2S2 — CID 5233038
N-[2-(4-chlorophenyl)sulfanylphenyl]-2-(3-methyl-4-oxoquinazolin-2-yl)sulfanylacetamide (PubChem CID 5233038) has the molecular formula C23H18ClN3O2S2 and a molecular weight of 468.00 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)sulfanylphenyl]-2-(3-methyl-4-oxoquinazolin-2-yl)sulfanylacetamide.
| Compound Name | N-[2-(4-chlorophenyl)sulfanylphenyl]-2-(3-methyl-4-oxoquinazolin-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 5233038 |
| Molecular Formula | C23H18ClN3O2S2 |
| Molecular Weight | 468.00 g/mol |
| Exact Mass | 467.05 |
| IUPAC Name | N-[2-(4-chlorophenyl)sulfanylphenyl]-2-(3-methyl-4-oxoquinazolin-2-yl)sulfanylacetamide |
| SMILES | Cn1c(SCC(=O)Nc2ccccc2Sc2ccc(Cl)cc2)nc2ccccc2c1=O |
| InChI | InChI=1S/C23H18ClN3O2S2/c1-27-22(29)17-6-2-3-7-18(17)26-23(27)30-14-21(28)25-19-8-4-5-9-20(19)31-16-12-10-15(24)11-13-16/h2-13H,14H2,1H3,(H,25,28) |
| InChIKey | WKNJJVLUMNTWBJ-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.00 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |