C19H17N3O5 — CID 55709062
methyl 2-[4-[[2-(4-oxocinnolin-1-yl)acetyl]amino]phenoxy]acetate (PubChem CID 55709062) has the molecular formula C19H17N3O5 and a molecular weight of 367.36 g/mol. Its IUPAC name is methyl 2-[4-[[2-(4-oxocinnolin-1-yl)acetyl]amino]phenoxy]acetate.
| Compound Name | methyl 2-[4-[[2-(4-oxocinnolin-1-yl)acetyl]amino]phenoxy]acetate |
|---|---|
| PubChem CID | 55709062 |
| Molecular Formula | C19H17N3O5 |
| Molecular Weight | 367.36 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | methyl 2-[4-[[2-(4-oxocinnolin-1-yl)acetyl]amino]phenoxy]acetate |
| SMILES | COC(=O)COc1ccc(NC(=O)Cn2ncc(=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C19H17N3O5/c1-26-19(25)12-27-14-8-6-13(7-9-14)21-18(24)11-22-16-5-3-2-4-15(16)17(23)10-20-22/h2-10H,11-12H2,1H3,(H,21,24) |
| InChIKey | LAQVHLMDROPIEA-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.36 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |