C20H26FN3O2 — CID 55743125
N-[[6-(diethylamino)-3-pyridinyl]methyl]-3-(3-fluoro-4-methoxyphenyl)propanamide (PubChem CID 55743125) has the molecular formula C20H26FN3O2 and a molecular weight of 359.45 g/mol. Its IUPAC name is N-[[6-(diethylamino)-3-pyridinyl]methyl]-3-(3-fluoro-4-methoxyphenyl)propanamide.
| Compound Name | N-[[6-(diethylamino)-3-pyridinyl]methyl]-3-(3-fluoro-4-methoxyphenyl)propanamide |
|---|---|
| PubChem CID | 55743125 |
| Molecular Formula | C20H26FN3O2 |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.20 |
| IUPAC Name | N-[[6-(diethylamino)-3-pyridinyl]methyl]-3-(3-fluoro-4-methoxyphenyl)propanamide |
| SMILES | CCN(CC)c1ccc(CNC(=O)CCc2ccc(OC)c(F)c2)cn1 |
| InChI | InChI=1S/C20H26FN3O2/c1-4-24(5-2)19-10-7-16(13-22-19)14-23-20(25)11-8-15-6-9-18(26-3)17(21)12-15/h6-7,9-10,12-13H,4-5,8,11,14H2,1-3H3,(H,23,25) |
| InChIKey | GLNIGPFTKUHSRM-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |