C21H28BrN3O4S — CID 55725310
2-bromo-N-[2-(N-ethyl-2-methylanilino)ethyl]-5-(2-methoxyethylsulfamoyl)benzamide (PubChem CID 55725310) has the molecular formula C21H28BrN3O4S and a molecular weight of 498.44 g/mol. Its IUPAC name is 2-bromo-N-[2-(N-ethyl-2-methylanilino)ethyl]-5-(2-methoxyethylsulfamoyl)benzamide.
| Compound Name | 2-bromo-N-[2-(N-ethyl-2-methylanilino)ethyl]-5-(2-methoxyethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 55725310 |
| Molecular Formula | C21H28BrN3O4S |
| Molecular Weight | 498.44 g/mol |
| Exact Mass | 497.10 |
| IUPAC Name | 2-bromo-N-[2-(N-ethyl-2-methylanilino)ethyl]-5-(2-methoxyethylsulfamoyl)benzamide |
| SMILES | CCN(CCNC(=O)c1cc(S(=O)(=O)NCCOC)ccc1Br)c1ccccc1C |
| InChI | InChI=1S/C21H28BrN3O4S/c1-4-25(20-8-6-5-7-16(20)2)13-11-23-21(26)18-15-17(9-10-19(18)22)30(27,28)24-12-14-29-3/h5-10,15,24H,4,11-14H2,1-3H3,(H,23,26) |
| InChIKey | DDMQHOUFQGGEFT-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.44 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|