C11H15N5O3S — CID 65231546
N-[2-(1H-imidazol-5-yl)ethyl]-1-methyl-4-sulfamoylpyrrole-2-carboxamide (PubChem CID 65231546) has the molecular formula C11H15N5O3S and a molecular weight of 297.34 g/mol. Its IUPAC name is N-[2-(1H-imidazol-5-yl)ethyl]-1-methyl-4-sulfamoylpyrrole-2-carboxamide.
| Compound Name | N-[2-(1H-imidazol-5-yl)ethyl]-1-methyl-4-sulfamoylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 65231546 |
| Molecular Formula | C11H15N5O3S |
| Molecular Weight | 297.34 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | N-[2-(1H-imidazol-5-yl)ethyl]-1-methyl-4-sulfamoylpyrrole-2-carboxamide |
| SMILES | Cn1cc(S(N)(=O)=O)cc1C(=O)NCCc1cnc[nH]1 |
| InChI | InChI=1S/C11H15N5O3S/c1-16-6-9(20(12,18)19)4-10(16)11(17)14-3-2-8-5-13-7-15-8/h4-7H,2-3H2,1H3,(H,13,15)(H,14,17)(H2,12,18,19) |
| InChIKey | AHTIYDNTYBYOQB-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 122.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.34 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |