C10H15ClN2O4S2 — CID 113488381
1-methyl-5-(3-methylsulfinylpropylcarbamoyl)pyrrole-3-sulfonyl chloride (PubChem CID 113488381) has the molecular formula C10H15ClN2O4S2 and a molecular weight of 326.83 g/mol. Its IUPAC name is 1-methyl-5-(3-methylsulfinylpropylcarbamoyl)pyrrole-3-sulfonyl chloride.
| Compound Name | 1-methyl-5-(3-methylsulfinylpropylcarbamoyl)pyrrole-3-sulfonyl chloride |
|---|---|
| PubChem CID | 113488381 |
| Molecular Formula | C10H15ClN2O4S2 |
| Molecular Weight | 326.83 g/mol |
| Exact Mass | 326.02 |
| IUPAC Name | 1-methyl-5-(3-methylsulfinylpropylcarbamoyl)pyrrole-3-sulfonyl chloride |
| SMILES | Cn1cc(S(=O)(=O)Cl)cc1C(=O)NCCCS(C)=O |
| InChI | InChI=1S/C10H15ClN2O4S2/c1-13-7-8(19(11,16)17)6-9(13)10(14)12-4-3-5-18(2)15/h6-7H,3-5H2,1-2H3,(H,12,14) |
| InChIKey | RALCLMAPORUHFB-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 85.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.83 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|