C11H17ClN2O4S2 — CID 114611553
5-(2-methylsulfinylethylcarbamoyl)-1-propan-2-ylpyrrole-3-sulfonyl chloride (PubChem CID 114611553) has the molecular formula C11H17ClN2O4S2 and a molecular weight of 340.85 g/mol. Its IUPAC name is 5-(2-methylsulfinylethylcarbamoyl)-1-propan-2-ylpyrrole-3-sulfonyl chloride.
| Compound Name | 5-(2-methylsulfinylethylcarbamoyl)-1-propan-2-ylpyrrole-3-sulfonyl chloride |
|---|---|
| PubChem CID | 114611553 |
| Molecular Formula | C11H17ClN2O4S2 |
| Molecular Weight | 340.85 g/mol |
| Exact Mass | 340.03 |
| IUPAC Name | 5-(2-methylsulfinylethylcarbamoyl)-1-propan-2-ylpyrrole-3-sulfonyl chloride |
| SMILES | CC(C)n1cc(S(=O)(=O)Cl)cc1C(=O)NCCS(C)=O |
| InChI | InChI=1S/C11H17ClN2O4S2/c1-8(2)14-7-9(20(12,17)18)6-10(14)11(15)13-4-5-19(3)16/h6-8H,4-5H2,1-3H3,(H,13,15) |
| InChIKey | OWAUBSQRKUUEBH-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 85.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.85 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |