C12H17ClN2O4S2 — CID 114611595
1-cyclopropyl-5-(2-ethylsulfinylethylcarbamoyl)pyrrole-3-sulfonyl chloride (PubChem CID 114611595) has the molecular formula C12H17ClN2O4S2 and a molecular weight of 352.87 g/mol. Its IUPAC name is 1-cyclopropyl-5-(2-ethylsulfinylethylcarbamoyl)pyrrole-3-sulfonyl chloride.
| Compound Name | 1-cyclopropyl-5-(2-ethylsulfinylethylcarbamoyl)pyrrole-3-sulfonyl chloride |
|---|---|
| PubChem CID | 114611595 |
| Molecular Formula | C12H17ClN2O4S2 |
| Molecular Weight | 352.87 g/mol |
| Exact Mass | 352.03 |
| IUPAC Name | 1-cyclopropyl-5-(2-ethylsulfinylethylcarbamoyl)pyrrole-3-sulfonyl chloride |
| SMILES | CCS(=O)CCNC(=O)c1cc(S(=O)(=O)Cl)cn1C1CC1 |
| InChI | InChI=1S/C12H17ClN2O4S2/c1-2-20(17)6-5-14-12(16)11-7-10(21(13,18)19)8-15(11)9-3-4-9/h7-9H,2-6H2,1H3,(H,14,16) |
| InChIKey | SDWUJJZEQUNSJL-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 85.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.87 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |