C9H11ClN2O3S — CID 114611033
1-cyclopropyl-5-(methylcarbamoyl)pyrrole-3-sulfonyl chloride (PubChem CID 114611033) has the molecular formula C9H11ClN2O3S and a molecular weight of 262.72 g/mol. Its IUPAC name is 1-cyclopropyl-5-(methylcarbamoyl)pyrrole-3-sulfonyl chloride.
| Compound Name | 1-cyclopropyl-5-(methylcarbamoyl)pyrrole-3-sulfonyl chloride |
|---|---|
| PubChem CID | 114611033 |
| Molecular Formula | C9H11ClN2O3S |
| Molecular Weight | 262.72 g/mol |
| Exact Mass | 262.02 |
| IUPAC Name | 1-cyclopropyl-5-(methylcarbamoyl)pyrrole-3-sulfonyl chloride |
| SMILES | CNC(=O)c1cc(S(=O)(=O)Cl)cn1C1CC1 |
| InChI | InChI=1S/C9H11ClN2O3S/c1-11-9(13)8-4-7(16(10,14)15)5-12(8)6-2-3-6/h4-6H,2-3H2,1H3,(H,11,13) |
| InChIKey | LRXQJWLZJUQEPA-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.72 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |