C13H19ClN2O3S — CID 114610992
1-cyclobutyl-5-(2-methylpropylcarbamoyl)pyrrole-3-sulfonyl chloride (PubChem CID 114610992) has the molecular formula C13H19ClN2O3S and a molecular weight of 318.83 g/mol. Its IUPAC name is 1-cyclobutyl-5-(2-methylpropylcarbamoyl)pyrrole-3-sulfonyl chloride.
| Compound Name | 1-cyclobutyl-5-(2-methylpropylcarbamoyl)pyrrole-3-sulfonyl chloride |
|---|---|
| PubChem CID | 114610992 |
| Molecular Formula | C13H19ClN2O3S |
| Molecular Weight | 318.83 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | 1-cyclobutyl-5-(2-methylpropylcarbamoyl)pyrrole-3-sulfonyl chloride |
| SMILES | CC(C)CNC(=O)c1cc(S(=O)(=O)Cl)cn1C1CCC1 |
| InChI | InChI=1S/C13H19ClN2O3S/c1-9(2)7-15-13(17)12-6-11(20(14,18)19)8-16(12)10-4-3-5-10/h6,8-10H,3-5,7H2,1-2H3,(H,15,17) |
| InChIKey | BJFVLCKGGMCKSI-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.83 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |