C12H15Cl2NO4S2 — CID 107100767
3-chloro-5-(2-ethylsulfinylethylcarbamoyl)-4-methylbenzenesulfonyl chloride (PubChem CID 107100767) has the molecular formula C12H15Cl2NO4S2 and a molecular weight of 372.30 g/mol. Its IUPAC name is 3-chloro-5-(2-ethylsulfinylethylcarbamoyl)-4-methylbenzenesulfonyl chloride.
| Compound Name | 3-chloro-5-(2-ethylsulfinylethylcarbamoyl)-4-methylbenzenesulfonyl chloride |
|---|---|
| PubChem CID | 107100767 |
| Molecular Formula | C12H15Cl2NO4S2 |
| Molecular Weight | 372.30 g/mol |
| Exact Mass | 370.98 |
| IUPAC Name | 3-chloro-5-(2-ethylsulfinylethylcarbamoyl)-4-methylbenzenesulfonyl chloride |
| SMILES | CCS(=O)CCNC(=O)c1cc(S(=O)(=O)Cl)cc(Cl)c1C |
| InChI | InChI=1S/C12H15Cl2NO4S2/c1-3-20(17)5-4-15-12(16)10-6-9(21(14,18)19)7-11(13)8(10)2/h6-7H,3-5H2,1-2H3,(H,15,16) |
| InChIKey | RJWCTRRZELULJI-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.30 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |