C13H17Cl2NO3S — CID 107100588
3-chloro-4-methyl-5-(pentan-3-ylcarbamoyl)benzenesulfonyl chloride (PubChem CID 107100588) has the molecular formula C13H17Cl2NO3S and a molecular weight of 338.26 g/mol. Its IUPAC name is 3-chloro-4-methyl-5-(pentan-3-ylcarbamoyl)benzenesulfonyl chloride.
| Compound Name | 3-chloro-4-methyl-5-(pentan-3-ylcarbamoyl)benzenesulfonyl chloride |
|---|---|
| PubChem CID | 107100588 |
| Molecular Formula | C13H17Cl2NO3S |
| Molecular Weight | 338.26 g/mol |
| Exact Mass | 337.03 |
| IUPAC Name | 3-chloro-4-methyl-5-(pentan-3-ylcarbamoyl)benzenesulfonyl chloride |
| SMILES | CCC(CC)NC(=O)c1cc(S(=O)(=O)Cl)cc(Cl)c1C |
| InChI | InChI=1S/C13H17Cl2NO3S/c1-4-9(5-2)16-13(17)11-6-10(20(15,18)19)7-12(14)8(11)3/h6-7,9H,4-5H2,1-3H3,(H,16,17) |
| InChIKey | ZDTBPNDJZLZMGU-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.26 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |