C9H13ClN2O3S — CID 65366824
5-[ethyl(methyl)carbamoyl]-1-methylpyrrole-3-sulfonyl chloride (PubChem CID 65366824) has the molecular formula C9H13ClN2O3S and a molecular weight of 264.73 g/mol. Its IUPAC name is 5-[ethyl(methyl)carbamoyl]-1-methylpyrrole-3-sulfonyl chloride.
| Compound Name | 5-[ethyl(methyl)carbamoyl]-1-methylpyrrole-3-sulfonyl chloride |
|---|---|
| PubChem CID | 65366824 |
| Molecular Formula | C9H13ClN2O3S |
| Molecular Weight | 264.73 g/mol |
| Exact Mass | 264.03 |
| IUPAC Name | 5-[ethyl(methyl)carbamoyl]-1-methylpyrrole-3-sulfonyl chloride |
| SMILES | CCN(C)C(=O)c1cc(S(=O)(=O)Cl)cn1C |
| InChI | InChI=1S/C9H13ClN2O3S/c1-4-11(2)9(13)8-5-7(6-12(8)3)16(10,14)15/h5-6H,4H2,1-3H3 |
| InChIKey | UIIFQISUVXWJNM-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 59.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.73 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |