C14H23ClN2O3S — CID 114611196
5-[methyl(2-methylbutyl)carbamoyl]-1-propylpyrrole-3-sulfonyl chloride (PubChem CID 114611196) has the molecular formula C14H23ClN2O3S and a molecular weight of 334.87 g/mol. Its IUPAC name is 5-[methyl(2-methylbutyl)carbamoyl]-1-propylpyrrole-3-sulfonyl chloride.
| Compound Name | 5-[methyl(2-methylbutyl)carbamoyl]-1-propylpyrrole-3-sulfonyl chloride |
|---|---|
| PubChem CID | 114611196 |
| Molecular Formula | C14H23ClN2O3S |
| Molecular Weight | 334.87 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | 5-[methyl(2-methylbutyl)carbamoyl]-1-propylpyrrole-3-sulfonyl chloride |
| SMILES | CCCn1cc(S(=O)(=O)Cl)cc1C(=O)N(C)CC(C)CC |
| InChI | InChI=1S/C14H23ClN2O3S/c1-5-7-17-10-12(21(15,19)20)8-13(17)14(18)16(4)9-11(3)6-2/h8,10-11H,5-7,9H2,1-4H3 |
| InChIKey | PINKUSWKLGYECD-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 59.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.87 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |