C13H21ClN2O4S — CID 114611174
1-(2-methoxyethyl)-5-[methyl(2-methylpropyl)carbamoyl]pyrrole-3-sulfonyl chloride (PubChem CID 114611174) has the molecular formula C13H21ClN2O4S and a molecular weight of 336.84 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-5-[methyl(2-methylpropyl)carbamoyl]pyrrole-3-sulfonyl chloride.
| Compound Name | 1-(2-methoxyethyl)-5-[methyl(2-methylpropyl)carbamoyl]pyrrole-3-sulfonyl chloride |
|---|---|
| PubChem CID | 114611174 |
| Molecular Formula | C13H21ClN2O4S |
| Molecular Weight | 336.84 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | 1-(2-methoxyethyl)-5-[methyl(2-methylpropyl)carbamoyl]pyrrole-3-sulfonyl chloride |
| SMILES | COCCn1cc(S(=O)(=O)Cl)cc1C(=O)N(C)CC(C)C |
| InChI | InChI=1S/C13H21ClN2O4S/c1-10(2)8-15(3)13(17)12-7-11(21(14,18)19)9-16(12)5-6-20-4/h7,9-10H,5-6,8H2,1-4H3 |
| InChIKey | ZOGYZQSDZMTIPO-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 68.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.84 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |