C12H19ClN2O3S — CID 65367186
5-(hexan-3-ylcarbamoyl)-1-methylpyrrole-3-sulfonyl chloride (PubChem CID 65367186) has the molecular formula C12H19ClN2O3S and a molecular weight of 306.81 g/mol. Its IUPAC name is 5-(hexan-3-ylcarbamoyl)-1-methylpyrrole-3-sulfonyl chloride.
| Compound Name | 5-(hexan-3-ylcarbamoyl)-1-methylpyrrole-3-sulfonyl chloride |
|---|---|
| PubChem CID | 65367186 |
| Molecular Formula | C12H19ClN2O3S |
| Molecular Weight | 306.81 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | 5-(hexan-3-ylcarbamoyl)-1-methylpyrrole-3-sulfonyl chloride |
| SMILES | CCCC(CC)NC(=O)c1cc(S(=O)(=O)Cl)cn1C |
| InChI | InChI=1S/C12H19ClN2O3S/c1-4-6-9(5-2)14-12(16)11-7-10(8-15(11)3)19(13,17)18/h7-9H,4-6H2,1-3H3,(H,14,16) |
| InChIKey | NKSUUDRPMZRKNG-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.81 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |