C20H27ClN2O3S — CID 114138398
1-benzyl-5-(octan-4-ylcarbamoyl)pyrrole-3-sulfonyl chloride (PubChem CID 114138398) has the molecular formula C20H27ClN2O3S and a molecular weight of 410.97 g/mol. Its IUPAC name is 1-benzyl-5-(octan-4-ylcarbamoyl)pyrrole-3-sulfonyl chloride.
| Compound Name | 1-benzyl-5-(octan-4-ylcarbamoyl)pyrrole-3-sulfonyl chloride |
|---|---|
| PubChem CID | 114138398 |
| Molecular Formula | C20H27ClN2O3S |
| Molecular Weight | 410.97 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | 1-benzyl-5-(octan-4-ylcarbamoyl)pyrrole-3-sulfonyl chloride |
| SMILES | CCCCC(CCC)NC(=O)c1cc(S(=O)(=O)Cl)cn1Cc1ccccc1 |
| InChI | InChI=1S/C20H27ClN2O3S/c1-3-5-12-17(9-4-2)22-20(24)19-13-18(27(21,25)26)15-23(19)14-16-10-7-6-8-11-16/h6-8,10-11,13,15,17H,3-5,9,12,14H2,1-2H3,(H,22,24) |
| InChIKey | GTHXNTYUNBIVQH-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.97 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |