About 2-cyclobutylethyl 4-chlorosulfonyl-1-propylpyrrole-2-carboxylate
2-cyclobutylethyl 4-chlorosulfonyl-1-propylpyrrole-2-carboxylate (PubChem CID 106207038) has the molecular formula C14H20ClNO4S
and a molecular weight of 333.84 g/mol. Its IUPAC name is 2-cyclobutylethyl 4-chlorosulfonyl-1-propylpyrrole-2-carboxylate.
Molecular Properties
| Compound Name | 2-cyclobutylethyl 4-chlorosulfonyl-1-propylpyrrole-2-carboxylate |
| PubChem CID | 106207038 |
| Molecular Formula | C14H20ClNO4S |
| Molecular Weight | 333.84 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | 2-cyclobutylethyl 4-chlorosulfonyl-1-propylpyrrole-2-carboxylate |
| SMILES | CCCn1cc(S(=O)(=O)Cl)cc1C(=O)OCCC1CCC1 |
| InChI | InChI=1S/C14H20ClNO4S/c1-2-7-16-10-12(21(15,18)19)9-13(16)14(17)20-8-6-11-4-3-5-11/h9-11H,2-8H2,1H3 |
| InChIKey | VHDBROPFTIZKNV-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 65.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.84 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-cyclobutylethyl 4-chlorosulfonyl-1-propylpyrrole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclobutylethyl 4-chlorosulfonyl-1-propylpyrrole-2-carboxylate?
The IUPAC name of 2-cyclobutylethyl 4-chlorosulfonyl-1-propylpyrrole-2-carboxylate (CID 106207038) is 2-cyclobutylethyl 4-chlorosulfonyl-1-propylpyrrole-2-carboxylate.
What is the SMILES notation for 2-cyclobutylethyl 4-chlorosulfonyl-1-propylpyrrole-2-carboxylate?
The canonical SMILES for 2-cyclobutylethyl 4-chlorosulfonyl-1-propylpyrrole-2-carboxylate is CCCn1cc(S(=O)(=O)Cl)cc1C(=O)OCCC1CCC1.
What is the InChIKey of 2-cyclobutylethyl 4-chlorosulfonyl-1-propylpyrrole-2-carboxylate?
The InChIKey is VHDBROPFTIZKNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20ClNO4S/c1-2-7-16-10-12(21(15,18)19)9-13(16)14(17)20-8-6-11-4-3-5-11/h9-11H,2-8H2,1H3.
What are the key properties of 2-cyclobutylethyl 4-chlorosulfonyl-1-propylpyrrole-2-carboxylate?
2-cyclobutylethyl 4-chlorosulfonyl-1-propylpyrrole-2-carboxylate has a molecular weight of 333.84 g/mol, XLogP of 3.17, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclobutylethyl 4-chlorosulfonyl-1-propylpyrrole-2-carboxylate is sourced from PubChem (CID 106207038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).