C15H20N4O2 — CID 61492986
3-imidazol-1-ylpropyl 3-amino-4-(dimethylamino)benzoate (PubChem CID 61492986) has the molecular formula C15H20N4O2 and a molecular weight of 288.35 g/mol. Its IUPAC name is 3-imidazol-1-ylpropyl 3-amino-4-(dimethylamino)benzoate.
| Compound Name | 3-imidazol-1-ylpropyl 3-amino-4-(dimethylamino)benzoate |
|---|---|
| PubChem CID | 61492986 |
| Molecular Formula | C15H20N4O2 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | 3-imidazol-1-ylpropyl 3-amino-4-(dimethylamino)benzoate |
| SMILES | CN(C)c1ccc(C(=O)OCCCn2ccnc2)cc1N |
| InChI | InChI=1S/C15H20N4O2/c1-18(2)14-5-4-12(10-13(14)16)15(20)21-9-3-7-19-8-6-17-11-19/h4-6,8,10-11H,3,7,9,16H2,1-2H3 |
| InChIKey | XBDCYOGXXYZOCU-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 73.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|