C17H29N3O3 — CID 59222872
4-[4-[[2-aminoethyl(methyl)amino]methyl]-3-methoxyphenoxy]-N-ethylbutanamide (PubChem CID 59222872) has the molecular formula C17H29N3O3 and a molecular weight of 323.44 g/mol. Its IUPAC name is 4-[4-[[2-aminoethyl(methyl)amino]methyl]-3-methoxyphenoxy]-N-ethylbutanamide.
| Compound Name | 4-[4-[[2-aminoethyl(methyl)amino]methyl]-3-methoxyphenoxy]-N-ethylbutanamide |
|---|---|
| PubChem CID | 59222872 |
| Molecular Formula | C17H29N3O3 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.22 |
| IUPAC Name | 4-[4-[[2-aminoethyl(methyl)amino]methyl]-3-methoxyphenoxy]-N-ethylbutanamide |
| SMILES | CCNC(=O)CCCOc1ccc(CN(C)CCN)c(OC)c1 |
| InChI | InChI=1S/C17H29N3O3/c1-4-19-17(21)6-5-11-23-15-8-7-14(16(12-15)22-3)13-20(2)10-9-18/h7-8,12H,4-6,9-11,13,18H2,1-3H3,(H,19,21) |
| InChIKey | BTFYPPYLJZDAKU-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|