C13H15O6- — CID 7006644
4-(4-formyl-3,5-dimethoxyphenoxy)butanoate (PubChem CID 7006644) has the molecular formula C13H15O6- and a molecular weight of 267.26 g/mol. Its IUPAC name is 4-(4-formyl-3,5-dimethoxyphenoxy)butanoate.
| Compound Name | 4-(4-formyl-3,5-dimethoxyphenoxy)butanoate |
|---|---|
| PubChem CID | 7006644 |
| Molecular Formula | C13H15O6- |
| Molecular Weight | 267.26 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | 4-(4-formyl-3,5-dimethoxyphenoxy)butanoate |
| SMILES | COc1cc(OCCCC(=O)[O-])cc(OC)c1C=O |
| InChI | InChI=1S/C13H16O6/c1-17-11-6-9(19-5-3-4-13(15)16)7-12(18-2)10(11)8-14/h6-8H,3-5H2,1-2H3,(H,15,16)/p-1 |
| InChIKey | SEJSVFHBVLKHLB-UHFFFAOYSA-M |
| XLogP | 0.43 |
| TPSA | 84.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.26 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|