C13H12O10 — CID 56974198
2-[3,5-bis(carboxymethoxy)-4-formylphenoxy]acetic acid (PubChem CID 56974198) has the molecular formula C13H12O10 and a molecular weight of 328.23 g/mol. Its IUPAC name is 2-[3,5-bis(carboxymethoxy)-4-formylphenoxy]acetic acid.
| Compound Name | 2-[3,5-bis(carboxymethoxy)-4-formylphenoxy]acetic acid |
|---|---|
| PubChem CID | 56974198 |
| Molecular Formula | C13H12O10 |
| Molecular Weight | 328.23 g/mol |
| Exact Mass | 328.04 |
| IUPAC Name | 2-[3,5-bis(carboxymethoxy)-4-formylphenoxy]acetic acid |
| SMILES | O=Cc1c(OCC(=O)O)cc(OCC(=O)O)cc1OCC(=O)O |
| InChI | InChI=1S/C13H12O10/c14-3-8-9(22-5-12(17)18)1-7(21-4-11(15)16)2-10(8)23-6-13(19)20/h1-3H,4-6H2,(H,15,16)(H,17,18)(H,19,20) |
| InChIKey | RJDISMZLYCAFCX-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 156.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.23 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|